C8H7BrN2OS — CID 61121832
5-bromo-N-(1-cyanoethyl)thiophene-2-carboxamide (PubChem CID 61121832) has the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. Its IUPAC name is 5-bromo-N-(1-cyanoethyl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(1-cyanoethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61121832 |
| Molecular Formula | C8H7BrN2OS |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | 5-bromo-N-(1-cyanoethyl)thiophene-2-carboxamide |
| SMILES | CC(C#N)NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H7BrN2OS/c1-5(4-10)11-8(12)6-2-3-7(9)13-6/h2-3,5H,1H3,(H,11,12) |
| InChIKey | ZYIOXNJPJLCKBX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |