C11H16BrNO2S — CID 61247480
5-bromo-N-(1-hydroxy-4-methylpentan-2-yl)thiophene-2-carboxamide (PubChem CID 61247480) has the molecular formula C11H16BrNO2S and a molecular weight of 306.23 g/mol. Its IUPAC name is 5-bromo-N-(1-hydroxy-4-methylpentan-2-yl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(1-hydroxy-4-methylpentan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61247480 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-bromo-N-(1-hydroxy-4-methylpentan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(C)CC(CO)NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrNO2S/c1-7(2)5-8(6-14)13-11(15)9-3-4-10(12)16-9/h3-4,7-8,14H,5-6H2,1-2H3,(H,13,15) |
| InChIKey | UHZZKZJOIKGUQS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |