C15H23BrN2O3S — CID 55865383
5-bromo-N-[1-[3-(2-methylpropoxy)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 55865383) has the molecular formula C15H23BrN2O3S and a molecular weight of 391.33 g/mol. Its IUPAC name is 5-bromo-N-[1-[3-(2-methylpropoxy)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[1-[3-(2-methylpropoxy)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55865383 |
| Molecular Formula | C15H23BrN2O3S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 5-bromo-N-[1-[3-(2-methylpropoxy)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(C)COCCCNC(=O)C(C)NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H23BrN2O3S/c1-10(2)9-21-8-4-7-17-14(19)11(3)18-15(20)12-5-6-13(16)22-12/h5-6,10-11H,4,7-9H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | WLILFPZMMLYIGX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|