C20H19NO4S2 — CID 69292192
methyl 5-[1-[5-(2-methoxyphenyl)thiophen-2-yl]ethylcarbamoyl]thiophene-2-carboxylate (PubChem CID 69292192) has the molecular formula C20H19NO4S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 5-[1-[5-(2-methoxyphenyl)thiophen-2-yl]ethylcarbamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[1-[5-(2-methoxyphenyl)thiophen-2-yl]ethylcarbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 69292192 |
| Molecular Formula | C20H19NO4S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | methyl 5-[1-[5-(2-methoxyphenyl)thiophen-2-yl]ethylcarbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NC(C)c2ccc(-c3ccccc3OC)s2)s1 |
| InChI | InChI=1S/C20H19NO4S2/c1-12(21-19(22)17-10-11-18(27-17)20(23)25-3)15-8-9-16(26-15)13-6-4-5-7-14(13)24-2/h4-12H,1-3H3,(H,21,22) |
| InChIKey | HYWJNXJVRYJFJI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |