C19H25NO4S — CID 46082797
N-(3-methylbutyl)-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide (PubChem CID 46082797) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-(3-methylbutyl)-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide.
| Compound Name | N-(3-methylbutyl)-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46082797 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-(3-methylbutyl)-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)NCCC(C)C)s2)c(OC)c1OC |
| InChI | InChI=1S/C19H25NO4S/c1-12(2)10-11-20-19(21)16-9-8-15(25-16)13-6-7-14(22-3)18(24-5)17(13)23-4/h6-9,12H,10-11H2,1-5H3,(H,20,21) |
| InChIKey | BNLJOLUJBWTTMG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |