C22H23NO4S — CID 92769174
N-[(1S)-1-phenylethyl]-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide (PubChem CID 92769174) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide.
| Compound Name | N-[(1S)-1-phenylethyl]-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 92769174 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-5-(2,3,4-trimethoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)N[C@@H](C)c3ccccc3)s2)c(OC)c1OC |
| InChI | InChI=1S/C22H23NO4S/c1-14(15-8-6-5-7-9-15)23-22(24)19-13-12-18(28-19)16-10-11-17(25-2)21(27-4)20(16)26-3/h5-14H,1-4H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | DDWWYTAKUXBHAD-AWEZNQCLSA-N |
| XLogP | 4.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |