C17H18N2O4 — CID 118221758
2,2-bis(2-methoxyphenyl)propanediamide (PubChem CID 118221758) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2,2-bis(2-methoxyphenyl)propanediamide.
| Compound Name | 2,2-bis(2-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 118221758 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2,2-bis(2-methoxyphenyl)propanediamide |
| SMILES | COc1ccccc1C(C(N)=O)(C(N)=O)c1ccccc1OC |
| InChI | InChI=1S/C17H18N2O4/c1-22-13-9-5-3-7-11(13)17(15(18)20,16(19)21)12-8-4-6-10-14(12)23-2/h3-10H,1-2H3,(H2,18,20)(H2,19,21) |
| InChIKey | XHDQYVBIOAUGSU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|