C11H14N2O5 — CID 70450290
2-(2,6-dimethoxyphenyl)-2-hydroxypropanediamide (PubChem CID 70450290) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenyl)-2-hydroxypropanediamide.
| Compound Name | 2-(2,6-dimethoxyphenyl)-2-hydroxypropanediamide |
|---|---|
| PubChem CID | 70450290 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-(2,6-dimethoxyphenyl)-2-hydroxypropanediamide |
| SMILES | COc1cccc(OC)c1C(O)(C(N)=O)C(N)=O |
| InChI | InChI=1S/C11H14N2O5/c1-17-6-4-3-5-7(18-2)8(6)11(16,9(12)14)10(13)15/h3-5,16H,1-2H3,(H2,12,14)(H2,13,15) |
| InChIKey | MCFIUMFSHFOETG-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|