C25H34O3 — CID 102115782
(2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-phenylbutanoate (PubChem CID 102115782) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-phenylbutanoate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 102115782 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-phenylbutanoate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)C[C@H](C)c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H34O3/c1-17(18-12-10-9-11-13-18)14-22(26)28-23-20(24(2,3)4)15-19(27-8)16-21(23)25(5,6)7/h9-13,15-17H,14H2,1-8H3/t17-/m0/s1 |
| InChIKey | YNZSHNDSRXCUPQ-KRWDZBQOSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|