C32H43NO3 — CID 15268806
(2,6-ditert-butyl-4-methoxyphenyl) 1-[di(propan-2-yl)amino]naphthalene-2-carboxylate (PubChem CID 15268806) has the molecular formula C32H43NO3 and a molecular weight of 489.70 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) 1-[di(propan-2-yl)amino]naphthalene-2-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) 1-[di(propan-2-yl)amino]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 15268806 |
| Molecular Formula | C32H43NO3 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) 1-[di(propan-2-yl)amino]naphthalene-2-carboxylate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)c2ccc3ccccc3c2N(C(C)C)C(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H43NO3/c1-20(2)33(21(3)4)28-24-15-13-12-14-22(24)16-17-25(28)30(34)36-29-26(31(5,6)7)18-23(35-11)19-27(29)32(8,9)10/h12-21H,1-11H3 |
| InChIKey | WALZHAVTRHQLIO-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|