C36H36O3 — CID 10506037
(2,6-ditert-butyl-4-methoxyphenyl) 1-naphthalen-1-ylnaphthalene-2-carboxylate (PubChem CID 10506037) has the molecular formula C36H36O3 and a molecular weight of 516.68 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) 1-naphthalen-1-ylnaphthalene-2-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) 1-naphthalen-1-ylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 10506037 |
| Molecular Formula | C36H36O3 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) 1-naphthalen-1-ylnaphthalene-2-carboxylate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)c2ccc3ccccc3c2-c2cccc3ccccc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H36O3/c1-35(2,3)30-21-25(38-7)22-31(36(4,5)6)33(30)39-34(37)29-20-19-24-14-9-11-17-27(24)32(29)28-18-12-15-23-13-8-10-16-26(23)28/h8-22H,1-7H3 |
| InChIKey | MBMSBWCAYSFDIF-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|