C36H31O4P — CID 159583139
bis(3,5-dimethoxyphenyl)-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane (PubChem CID 159583139) has the molecular formula C36H31O4P and a molecular weight of 558.61 g/mol. Its IUPAC name is bis(3,5-dimethoxyphenyl)-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane.
| Compound Name | bis(3,5-dimethoxyphenyl)-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane |
|---|---|
| PubChem CID | 159583139 |
| Molecular Formula | C36H31O4P |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | bis(3,5-dimethoxyphenyl)-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane |
| SMILES | COc1cc(OC)cc(P(c2cc(OC)cc(OC)c2)c2ccc3ccccc3c2-c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C36H31O4P/c1-37-26-18-27(38-2)21-30(20-26)41(31-22-28(39-3)19-29(23-31)40-4)35-17-16-25-11-6-8-14-33(25)36(35)34-15-9-12-24-10-5-7-13-32(24)34/h5-23H,1-4H3 |
| InChIKey | MJGSCWVSMBJDKL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|