C44H39N2O4PS — CID 53381412
1-benzyl-3-[1-[2-bis(3,5-dimethoxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]thiourea (PubChem CID 53381412) has the molecular formula C44H39N2O4PS and a molecular weight of 722.85 g/mol. Its IUPAC name is 1-benzyl-3-[1-[2-bis(3,5-dimethoxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]thiourea.
| Compound Name | 1-benzyl-3-[1-[2-bis(3,5-dimethoxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]thiourea |
|---|---|
| PubChem CID | 53381412 |
| Molecular Formula | C44H39N2O4PS |
| Molecular Weight | 722.85 g/mol |
| Exact Mass | 722.24 |
| IUPAC Name | 1-benzyl-3-[1-[2-bis(3,5-dimethoxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]thiourea |
| SMILES | COc1cc(OC)cc(P(c2cc(OC)cc(OC)c2)c2ccc3ccccc3c2-c2c(NC(=S)NCc3ccccc3)ccc3ccccc23)c1 |
| InChI | InChI=1S/C44H39N2O4PS/c1-47-32-22-33(48-2)25-36(24-32)51(37-26-34(49-3)23-35(27-37)50-4)41-21-19-31-15-9-11-17-39(31)43(41)42-38-16-10-8-14-30(38)18-20-40(42)46-44(52)45-28-29-12-6-5-7-13-29/h5-27H,28H2,1-4H3,(H2,45,46,52) |
| InChIKey | RRKBCLHNMNYWOT-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.85 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|