C42H29F6N2PS — CID 53356393
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]thiourea (PubChem CID 53356393) has the molecular formula C42H29F6N2PS and a molecular weight of 738.74 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]thiourea.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]thiourea |
|---|---|
| PubChem CID | 53356393 |
| Molecular Formula | C42H29F6N2PS |
| Molecular Weight | 738.74 g/mol |
| Exact Mass | 738.17 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(CNC(=S)Nc2ccc3ccccc3c2-c2c(P(c3ccccc3)c3ccccc3)ccc3ccccc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C42H29F6N2PS/c43-41(44,45)30-23-27(24-31(25-30)42(46,47)48)26-49-40(52)50-36-21-19-28-11-7-9-17-34(28)38(36)39-35-18-10-8-12-29(35)20-22-37(39)51(32-13-3-1-4-14-32)33-15-5-2-6-16-33/h1-25H,26H2,(H2,49,50,52) |
| InChIKey | IGOFZWUROGZALH-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.74 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|