C48H28F12P2 — CID 21470378
[1-[2-bis[4-(trifluoromethyl)phenyl]phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis[4-(trifluoromethyl)phenyl]phosphane (PubChem CID 21470378) has the molecular formula C48H28F12P2 and a molecular weight of 894.68 g/mol. Its IUPAC name is [1-[2-bis[4-(trifluoromethyl)phenyl]phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis[4-(trifluoromethyl)phenyl]phosphane.
| Compound Name | [1-[2-bis[4-(trifluoromethyl)phenyl]phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis[4-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 21470378 |
| Molecular Formula | C48H28F12P2 |
| Molecular Weight | 894.68 g/mol |
| Exact Mass | 894.15 |
| IUPAC Name | [1-[2-bis[4-(trifluoromethyl)phenyl]phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis[4-(trifluoromethyl)phenyl]phosphane |
| SMILES | FC(F)(F)c1ccc(P(c2ccc(C(F)(F)F)cc2)c2ccc3ccccc3c2-c2c(P(c3ccc(C(F)(F)F)cc3)c3ccc(C(F)(F)F)cc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C48H28F12P2/c49-45(50,51)31-11-19-35(20-12-31)61(36-21-13-32(14-22-36)46(52,53)54)41-27-9-29-5-1-3-7-39(29)43(41)44-40-8-4-2-6-30(40)10-28-42(44)62(37-23-15-33(16-24-37)47(55,56)57)38-25-17-34(18-26-38)48(58,59)60/h1-28H |
| InChIKey | UPWLSJDPJDITKL-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.68 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|