C44H32O4P2 — CID 102082604
4-[[1-[2-bis(4-hydroxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-(4-hydroxyphenyl)phosphanyl]phenol (PubChem CID 102082604) has the molecular formula C44H32O4P2 and a molecular weight of 686.68 g/mol. Its IUPAC name is 4-[[1-[2-bis(4-hydroxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-(4-hydroxyphenyl)phosphanyl]phenol.
| Compound Name | 4-[[1-[2-bis(4-hydroxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-(4-hydroxyphenyl)phosphanyl]phenol |
|---|---|
| PubChem CID | 102082604 |
| Molecular Formula | C44H32O4P2 |
| Molecular Weight | 686.68 g/mol |
| Exact Mass | 686.18 |
| IUPAC Name | 4-[[1-[2-bis(4-hydroxyphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-(4-hydroxyphenyl)phosphanyl]phenol |
| SMILES | Oc1ccc(P(c2ccc(O)cc2)c2ccc3ccccc3c2-c2c(P(c3ccc(O)cc3)c3ccc(O)cc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C44H32O4P2/c45-31-11-19-35(20-12-31)49(36-21-13-32(46)14-22-36)41-27-9-29-5-1-3-7-39(29)43(41)44-40-8-4-2-6-30(40)10-28-42(44)50(37-23-15-33(47)16-24-37)38-25-17-34(48)18-26-38/h1-28,45-48H |
| InChIKey | QIGIGHLCLDLDJC-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.68 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|