C25H27BrO2 — CID 11328103
(3,5-ditert-butylphenyl) 1-bromonaphthalene-2-carboxylate (PubChem CID 11328103) has the molecular formula C25H27BrO2 and a molecular weight of 439.39 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl) 1-bromonaphthalene-2-carboxylate.
| Compound Name | (3,5-ditert-butylphenyl) 1-bromonaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11328103 |
| Molecular Formula | C25H27BrO2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (3,5-ditert-butylphenyl) 1-bromonaphthalene-2-carboxylate |
| SMILES | CC(C)(C)c1cc(OC(=O)c2ccc3ccccc3c2Br)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H27BrO2/c1-24(2,3)17-13-18(25(4,5)6)15-19(14-17)28-23(27)21-12-11-16-9-7-8-10-20(16)22(21)26/h7-15H,1-6H3 |
| InChIKey | KGDARMLMSYHWJT-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|