About 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate
2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate (PubChem CID 66847564) has the molecular formula C31H26O5
and a molecular weight of 478.54 g/mol. Its IUPAC name is 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate |
| PubChem CID | 66847564 |
| Molecular Formula | C31H26O5 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(Oc1ccccc1)c1ccc2ccccc2c1O.c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C17H12O3.C14H14O2/c18-16-14-9-5-4-6-12(14)10-11-15(16)17(19)20-13-7-2-1-3-8-13;1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-11,18H;1-10H,11-12H2 |
| InChIKey | HMPQDHKPIVUMMX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate?
The IUPAC name of 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate (CID 66847564) is 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate.
What is the SMILES notation for 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate?
The canonical SMILES for 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate is O=C(Oc1ccccc1)c1ccc2ccccc2c1O.c1ccc(OCCOc2ccccc2)cc1.
What is the InChIKey of 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate?
The InChIKey is HMPQDHKPIVUMMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O3.C14H14O2/c18-16-14-9-5-4-6-12(14)10-11-15(16)17(19)20-13-7-2-1-3-8-13;1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-11,18H;1-10H,11-12H2.
What are the key properties of 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate?
2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate has a molecular weight of 478.54 g/mol, XLogP of 6.91, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethoxybenzene;phenyl 1-hydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 66847564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).