C26H30O3 — CID 11014638
(2,6-ditert-butyl-4-methoxyphenyl) naphthalene-1-carboxylate (PubChem CID 11014638) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) naphthalene-1-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11014638 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) naphthalene-1-carboxylate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)c2cccc3ccccc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H30O3/c1-25(2,3)21-15-18(28-7)16-22(26(4,5)6)23(21)29-24(27)20-14-10-12-17-11-8-9-13-19(17)20/h8-16H,1-7H3 |
| InChIKey | ZCFFOJZLJKYFLL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|