C30H42O3Si — CID 132542217
2-tert-butyl-4-methoxy-6-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]phenol (PubChem CID 132542217) has the molecular formula C30H42O3Si and a molecular weight of 478.75 g/mol. Its IUPAC name is 2-tert-butyl-4-methoxy-6-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]phenol.
| Compound Name | 2-tert-butyl-4-methoxy-6-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]phenol |
|---|---|
| PubChem CID | 132542217 |
| Molecular Formula | C30H42O3Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 2-tert-butyl-4-methoxy-6-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]phenol |
| SMILES | COc1cc(-c2c(O[Si](C(C)C)(C(C)C)C(C)C)ccc3ccccc23)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H42O3Si/c1-19(2)34(20(3)4,21(5)6)33-27-16-15-22-13-11-12-14-24(22)28(27)25-17-23(32-10)18-26(29(25)31)30(7,8)9/h11-21,31H,1-10H3 |
| InChIKey | WCPUWRKHFUAODY-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|