C29H40O5 — CID 11048948
(2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-methyl-2-oxo-6-phenylmethoxyhexanoate (PubChem CID 11048948) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-methyl-2-oxo-6-phenylmethoxyhexanoate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-methyl-2-oxo-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 11048948 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) (3S)-3-methyl-2-oxo-6-phenylmethoxyhexanoate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)C(=O)[C@@H](C)CCCOCc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H40O5/c1-20(13-12-16-33-19-21-14-10-9-11-15-21)25(30)27(31)34-26-23(28(2,3)4)17-22(32-8)18-24(26)29(5,6)7/h9-11,14-15,17-18,20H,12-13,16,19H2,1-8H3/t20-/m0/s1 |
| InChIKey | ZZAJFXBKGAEEMS-FQEVSTJZSA-N |
| XLogP | 6.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|