C21H36O3 — CID 11404946
(4S,5S,6S)-5-methyl-6-[(2-methylpropan-2-yl)oxy]-9-phenylmethoxynonan-4-ol (PubChem CID 11404946) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (4S,5S,6S)-5-methyl-6-[(2-methylpropan-2-yl)oxy]-9-phenylmethoxynonan-4-ol.
| Compound Name | (4S,5S,6S)-5-methyl-6-[(2-methylpropan-2-yl)oxy]-9-phenylmethoxynonan-4-ol |
|---|---|
| PubChem CID | 11404946 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (4S,5S,6S)-5-methyl-6-[(2-methylpropan-2-yl)oxy]-9-phenylmethoxynonan-4-ol |
| SMILES | CCC[C@H](O)[C@H](C)[C@H](CCCOCc1ccccc1)OC(C)(C)C |
| InChI | InChI=1S/C21H36O3/c1-6-11-19(22)17(2)20(24-21(3,4)5)14-10-15-23-16-18-12-8-7-9-13-18/h7-9,12-13,17,19-20,22H,6,10-11,14-16H2,1-5H3/t17-,19-,20-/m0/s1 |
| InChIKey | QHKZQQREBKLNRB-IHPCNDPISA-N |
| XLogP | 4.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|