C43H80O3 — CID 139255028
2,18-dimethyl-6,14-bis(4-methylpentyl)-10-(3-phenylmethoxypropyl)nonadecane-6,14-diol (PubChem CID 139255028) has the molecular formula C43H80O3 and a molecular weight of 645.11 g/mol. Its IUPAC name is 2,18-dimethyl-6,14-bis(4-methylpentyl)-10-(3-phenylmethoxypropyl)nonadecane-6,14-diol.
| Compound Name | 2,18-dimethyl-6,14-bis(4-methylpentyl)-10-(3-phenylmethoxypropyl)nonadecane-6,14-diol |
|---|---|
| PubChem CID | 139255028 |
| Molecular Formula | C43H80O3 |
| Molecular Weight | 645.11 g/mol |
| Exact Mass | 644.61 |
| IUPAC Name | 2,18-dimethyl-6,14-bis(4-methylpentyl)-10-(3-phenylmethoxypropyl)nonadecane-6,14-diol |
| SMILES | CC(C)CCCC(O)(CCCC(C)C)CCCC(CCCOCc1ccccc1)CCCC(O)(CCCC(C)C)CCCC(C)C |
| InChI | InChI=1S/C43H80O3/c1-36(2)19-12-28-42(44,29-13-20-37(3)4)32-16-25-40(27-18-34-46-35-41-23-10-9-11-24-41)26-17-33-43(45,30-14-21-38(5)6)31-15-22-39(7)8/h9-11,23-24,36-40,44-45H,12-22,25-35H2,1-8H3 |
| InChIKey | VNANHOLXPFSLRA-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.11 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|