C32H40O6 — CID 53359239
(2S,3S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-methyl-8-phenylmethoxyoctanal (PubChem CID 53359239) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is (2S,3S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-methyl-8-phenylmethoxyoctanal.
| Compound Name | (2S,3S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-methyl-8-phenylmethoxyoctanal |
|---|---|
| PubChem CID | 53359239 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (2S,3S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-methyl-8-phenylmethoxyoctanal |
| SMILES | COc1ccc(CO[C@H](CCCOCc2ccccc2)C[C@H](OCc2ccc(OC)cc2)C(C)C=O)cc1 |
| InChI | InChI=1S/C32H40O6/c1-25(21-33)32(38-24-28-13-17-30(35-3)18-14-28)20-31(37-23-27-11-15-29(34-2)16-12-27)10-7-19-36-22-26-8-5-4-6-9-26/h4-6,8-9,11-18,21,25,31-32H,7,10,19-20,22-24H2,1-3H3/t25?,31-,32+/m1/s1 |
| InChIKey | UHKXILUOVFIBMF-STNMYDAVSA-N |
| XLogP | 6.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|