C24H32O3 — CID 25269716
(7S)-7,10-bis(phenylmethoxy)decanal (PubChem CID 25269716) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (7S)-7,10-bis(phenylmethoxy)decanal.
| Compound Name | (7S)-7,10-bis(phenylmethoxy)decanal |
|---|---|
| PubChem CID | 25269716 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (7S)-7,10-bis(phenylmethoxy)decanal |
| SMILES | O=CCCCCC[C@@H](CCCOCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H32O3/c25-18-10-2-1-9-16-24(27-21-23-14-7-4-8-15-23)17-11-19-26-20-22-12-5-3-6-13-22/h3-8,12-15,18,24H,1-2,9-11,16-17,19-21H2/t24-/m0/s1 |
| InChIKey | JCMOGIQLOWLALH-DEOSSOPVSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|