About 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate
2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate (PubChem CID 160511208) has the molecular formula C16H24O3
and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate.
Molecular Properties
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate |
| PubChem CID | 160511208 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate |
| SMILES | CC(CC(=O)OCCOC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H24O3/c1-13(14-8-6-5-7-9-14)12-15(17)18-10-11-19-16(2,3)4/h5-9,13H,10-12H2,1-4H3 |
| InChIKey | YWRHYHOLRBQMFS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate?
The IUPAC name of 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate (CID 160511208) is 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate.
What is the SMILES notation for 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate?
The canonical SMILES for 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate is CC(CC(=O)OCCOC(C)(C)C)c1ccccc1.
What is the InChIKey of 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate?
The InChIKey is YWRHYHOLRBQMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-13(14-8-6-5-7-9-14)12-15(17)18-10-11-19-16(2,3)4/h5-9,13H,10-12H2,1-4H3.
What are the key properties of 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate?
2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate has a molecular weight of 264.36 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylpropan-2-yl)oxy]ethyl 3-phenylbutanoate is sourced from PubChem (CID 160511208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).