C19H19NO5S — CID 7265821
2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (3S)-3-phenylbutanoate (PubChem CID 7265821) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (3S)-3-phenylbutanoate.
| Compound Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7265821 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)OCCN1C(=O)c2ccccc2S1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO5S/c1-14(15-7-3-2-4-8-15)13-18(21)25-12-11-20-19(22)16-9-5-6-10-17(16)26(20,23)24/h2-10,14H,11-13H2,1H3/t14-/m0/s1 |
| InChIKey | BEVDAFZXYVQSSB-AWEZNQCLSA-N |
| XLogP | 2.57 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |