C23H26N2O7S — CID 124824276
2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate (PubChem CID 124824276) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate.
| Compound Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 124824276 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](C(=O)OCCN1C(=O)c2ccccc2S1(=O)=O)N1C(=O)[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C23H26N2O7S/c1-14(2)13-18(25-21(27)15-7-3-4-8-16(15)22(25)28)23(29)32-12-11-24-20(26)17-9-5-6-10-19(17)33(24,30)31/h3-6,9-10,14-16,18H,7-8,11-13H2,1-2H3/t15-,16-,18-/m1/s1 |
| InChIKey | FJJBEYMJYOMHMZ-JFIYKMOQSA-N |
| XLogP | 1.74 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|