C24H30N2O6 — CID 2338971
[2-(2-ethoxyanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate (PubChem CID 2338971) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 2338971 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)[C@H](CC(C)C)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C24H30N2O6/c1-4-31-20-12-8-7-11-18(20)25-21(27)14-32-24(30)19(13-15(2)3)26-22(28)16-9-5-6-10-17(16)23(26)29/h5-8,11-12,15-17,19H,4,9-10,13-14H2,1-3H3,(H,25,27)/t16-,17+,19-/m0/s1 |
| InChIKey | BDXWZQDDAWXFHA-SCTDSRPQSA-N |
| XLogP | 2.93 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|