C22H24ClN3O7 — CID 42965721
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate (PubChem CID 42965721) has the molecular formula C22H24ClN3O7 and a molecular weight of 477.90 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 42965721 |
| Molecular Formula | C22H24ClN3O7 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-])N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C22H24ClN3O7/c1-12(2)9-18(25-20(28)14-5-3-4-6-15(14)21(25)29)22(30)33-11-19(27)24-16-8-7-13(23)10-17(16)26(31)32/h3-4,7-8,10,12,14-15,18H,5-6,9,11H2,1-2H3,(H,24,27) |
| InChIKey | HJRQBVLHXBCHIZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|