C23H26ClN3O7 — CID 42969128
[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate (PubChem CID 42969128) has the molecular formula C23H26ClN3O7 and a molecular weight of 491.93 g/mol. Its IUPAC name is [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 42969128 |
| Molecular Formula | C23H26ClN3O7 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OC(C)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C23H26ClN3O7/c1-12(2)10-19(26-21(29)15-6-4-5-7-16(15)22(26)30)23(31)34-13(3)20(28)25-18-11-14(27(32)33)8-9-17(18)24/h4-5,8-9,11-13,15-16,19H,6-7,10H2,1-3H3,(H,25,28) |
| InChIKey | GADUWEGZHZOERF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|