C22H26Cl2N2O3 — CID 42906498
N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide (PubChem CID 42906498) has the molecular formula C22H26Cl2N2O3 and a molecular weight of 437.37 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 42906498 |
| Molecular Formula | C22H26Cl2N2O3 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NC(C)c1ccc(Cl)c(Cl)c1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C22H26Cl2N2O3/c1-12(2)10-19(26-21(28)15-6-4-5-7-16(15)22(26)29)20(27)25-13(3)14-8-9-17(23)18(24)11-14/h4-5,8-9,11-13,15-16,19H,6-7,10H2,1-3H3,(H,25,27) |
| InChIKey | ZHJHWQJOQPSQLR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|