C25H34N2O4 — CID 51950156
(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[(1S)-1-(3-propan-2-yloxyphenyl)ethyl]pentanamide (PubChem CID 51950156) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[(1S)-1-(3-propan-2-yloxyphenyl)ethyl]pentanamide.
| Compound Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[(1S)-1-(3-propan-2-yloxyphenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 51950156 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[(1S)-1-(3-propan-2-yloxyphenyl)ethyl]pentanamide |
| SMILES | CC(C)C[C@H](C(=O)N[C@@H](C)c1cccc(OC(C)C)c1)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C25H34N2O4/c1-15(2)13-22(27-24(29)20-11-6-7-12-21(20)25(27)30)23(28)26-17(5)18-9-8-10-19(14-18)31-16(3)4/h6-10,14-17,20-22H,11-13H2,1-5H3,(H,26,28)/t17-,20-,21+,22+/m0/s1 |
| InChIKey | ZYQXEWFUBRJMPA-GUGJDKNPSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|