C23H30N2O4 — CID 24681315
2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methyl-N-[2-(4-methylphenoxy)ethyl]pentanamide (PubChem CID 24681315) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methyl-N-[2-(4-methylphenoxy)ethyl]pentanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methyl-N-[2-(4-methylphenoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 24681315 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methyl-N-[2-(4-methylphenoxy)ethyl]pentanamide |
| SMILES | Cc1ccc(OCCNC(=O)C(CC(C)C)N2C(=O)C3CC=CCC3C2=O)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-15(2)14-20(25-22(27)18-6-4-5-7-19(18)23(25)28)21(26)24-12-13-29-17-10-8-16(3)9-11-17/h4-5,8-11,15,18-20H,6-7,12-14H2,1-3H3,(H,24,26) |
| InChIKey | NYCGYFCYSFFFNA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|