C21H25FN2O3 — CID 46796627
2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide (PubChem CID 46796627) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide.
| Compound Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 46796627 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide |
| SMILES | Cc1ccc(NC(=O)C(CC(C)C)N2C(=O)C3CC=CCC3C2=O)c(F)c1 |
| InChI | InChI=1S/C21H25FN2O3/c1-12(2)10-18(19(25)23-17-9-8-13(3)11-16(17)22)24-20(26)14-6-4-5-7-15(14)21(24)27/h4-5,8-9,11-12,14-15,18H,6-7,10H2,1-3H3,(H,23,25) |
| InChIKey | FYBMAGPWPMISKH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|