C20H22ClFN2O3 — CID 51477710
(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-chloro-4-fluorophenyl)-4-methylpentanamide (PubChem CID 51477710) has the molecular formula C20H22ClFN2O3 and a molecular weight of 392.86 g/mol. Its IUPAC name is (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-chloro-4-fluorophenyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-chloro-4-fluorophenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 51477710 |
| Molecular Formula | C20H22ClFN2O3 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3-chloro-4-fluorophenyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(=O)Nc1ccc(F)c(Cl)c1)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C20H22ClFN2O3/c1-11(2)9-17(18(25)23-12-7-8-16(22)15(21)10-12)24-19(26)13-5-3-4-6-14(13)20(24)27/h3-4,7-8,10-11,13-14,17H,5-6,9H2,1-2H3,(H,23,25)/t13-,14+,17-/m0/s1 |
| InChIKey | CMRQGHRWOKPBJA-VBQJREDUSA-N |
| XLogP | 3.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|