C23H24N2O5 — CID 124840322
(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-(2-oxochromen-6-yl)pentanamide (PubChem CID 124840322) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-(2-oxochromen-6-yl)pentanamide.
| Compound Name | (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-(2-oxochromen-6-yl)pentanamide |
|---|---|
| PubChem CID | 124840322 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-(2-oxochromen-6-yl)pentanamide |
| SMILES | CC(C)C[C@H](C(=O)Nc1ccc2oc(=O)ccc2c1)N1C(=O)[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C23H24N2O5/c1-13(2)11-18(25-22(28)16-5-3-4-6-17(16)23(25)29)21(27)24-15-8-9-19-14(12-15)7-10-20(26)30-19/h3-4,7-10,12-13,16-18H,5-6,11H2,1-2H3,(H,24,27)/t16-,17-,18-/m1/s1 |
| InChIKey | XCABACVEJLDWJS-KZNAEPCWSA-N |
| XLogP | 3.10 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|