C25H33N3O4 — CID 46540192
N-tert-butyl-4-[[2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoyl]amino]benzamide (PubChem CID 46540192) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-tert-butyl-4-[[2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoyl]amino]benzamide.
| Compound Name | N-tert-butyl-4-[[2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoyl]amino]benzamide |
|---|---|
| PubChem CID | 46540192 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-tert-butyl-4-[[2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoyl]amino]benzamide |
| SMILES | CC(C)CC(C(=O)Nc1ccc(C(=O)NC(C)(C)C)cc1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C25H33N3O4/c1-15(2)14-20(28-23(31)18-8-6-7-9-19(18)24(28)32)22(30)26-17-12-10-16(11-13-17)21(29)27-25(3,4)5/h6-7,10-13,15,18-20H,8-9,14H2,1-5H3,(H,26,30)(H,27,29) |
| InChIKey | MPIBUEXQDTYLJK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|