C20H23BrN2O3 — CID 112760674
N-(3-bromophenyl)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide (PubChem CID 112760674) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-(3-bromophenyl)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 112760674 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-(3-bromophenyl)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)Nc1cccc(Br)c1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C20H23BrN2O3/c1-12(2)10-17(18(24)22-14-7-5-6-13(21)11-14)23-19(25)15-8-3-4-9-16(15)20(23)26/h3-7,11-12,15-17H,8-10H2,1-2H3,(H,22,24) |
| InChIKey | VACPMNNENRFELZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|