C19H19N3O8 — CID 25412159
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 25412159) has the molecular formula C19H19N3O8 and a molecular weight of 417.37 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 25412159 |
| Molecular Formula | C19H19N3O8 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)CN2C(=O)[C@H]3CC=CC[C@H]3C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O8/c1-29-11-6-7-14(15(8-11)22(27)28)20-16(23)10-30-17(24)9-21-18(25)12-4-2-3-5-13(12)19(21)26/h2-3,6-8,12-13H,4-5,9-10H2,1H3,(H,20,23)/t12-,13+ |
| InChIKey | FYCVBUQHXKODIT-BETUJISGSA-N |
| XLogP | 1.04 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|