C18H15Cl3N2O5 — CID 46794450
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate (PubChem CID 46794450) has the molecular formula C18H15Cl3N2O5 and a molecular weight of 445.69 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 46794450 |
| Molecular Formula | C18H15Cl3N2O5 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)C2CC=CCC2C1=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3N2O5/c19-11-5-13(21)14(6-12(11)20)22-15(24)8-28-16(25)7-23-17(26)9-3-1-2-4-10(9)18(23)27/h1-2,5-6,9-10H,3-4,7-8H2,(H,22,24) |
| InChIKey | DSGHKSQJESMACV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|