C26H28N2O5 — CID 98329510
[2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate (PubChem CID 98329510) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 98329510 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](C(=O)OCC(=O)Nc1cccc2ccccc12)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C26H28N2O5/c1-16(2)14-22(28-24(30)19-11-5-6-12-20(19)25(28)31)26(32)33-15-23(29)27-21-13-7-9-17-8-3-4-10-18(17)21/h3-10,13,16,19-20,22H,11-12,14-15H2,1-2H3,(H,27,29)/t19-,20+,22-/m1/s1 |
| InChIKey | CYXIWMMECLFHTN-RZUBCFFCSA-N |
| XLogP | 3.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|