C23H26N2O7 — CID 98273955
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate (PubChem CID 98273955) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 98273955 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)OCC(=O)Nc1ccc2c(c1)OCO2)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C23H26N2O7/c1-13(2)9-17(25-21(27)15-5-3-4-6-16(15)22(25)28)23(29)30-11-20(26)24-14-7-8-18-19(10-14)32-12-31-18/h3-4,7-8,10,13,15-17H,5-6,9,11-12H2,1-2H3,(H,24,26)/t15-,16+,17-/m0/s1 |
| InChIKey | IDUHILHDQLCMOQ-BBWFWOEESA-N |
| XLogP | 2.26 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|