C27H33N3O6 — CID 129420019
1-[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoyl]-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide (PubChem CID 129420019) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is 1-[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoyl]-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoyl]-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 129420019 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 1-[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methylpentanoyl]-N-(1,3-benzodioxol-5-yl)piperidine-4-carboxamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCC(C(=O)Nc2ccc3c(c2)OCO3)CC1)N1C(=O)[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C27H33N3O6/c1-16(2)13-21(30-25(32)19-5-3-4-6-20(19)26(30)33)27(34)29-11-9-17(10-12-29)24(31)28-18-7-8-22-23(14-18)36-15-35-22/h3-4,7-8,14,16-17,19-21H,5-6,9-13,15H2,1-2H3,(H,28,31)/t19-,20-,21-/m1/s1 |
| InChIKey | PMKLVQXYRMQLLJ-NJDAHSKKSA-N |
| XLogP | 2.96 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|