C20H21NO7S — CID 8708061
2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 3,4-diethoxybenzoate (PubChem CID 8708061) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 3,4-diethoxybenzoate.
| Compound Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 8708061 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCCN2C(=O)c3ccccc3S2(=O)=O)cc1OCC |
| InChI | InChI=1S/C20H21NO7S/c1-3-26-16-10-9-14(13-17(16)27-4-2)20(23)28-12-11-21-19(22)15-7-5-6-8-18(15)29(21,24)25/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | DFSDFMOAPBXVAZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |