C18H18N2O7S2 — CID 2456327
2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 4-(dimethylsulfamoyl)benzoate (PubChem CID 2456327) has the molecular formula C18H18N2O7S2 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 4-(dimethylsulfamoyl)benzoate.
| Compound Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2456327 |
| Molecular Formula | C18H18N2O7S2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 4-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)OCCN2C(=O)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C18H18N2O7S2/c1-19(2)28(23,24)14-9-7-13(8-10-14)18(22)27-12-11-20-17(21)15-5-3-4-6-16(15)29(20,25)26/h3-10H,11-12H2,1-2H3 |
| InChIKey | SQHDRGZZRGNKJQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |