C17H13N3O5S — CID 40608737
2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 1H-indazole-3-carboxylate (PubChem CID 40608737) has the molecular formula C17H13N3O5S and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 1H-indazole-3-carboxylate.
| Compound Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 40608737 |
| Molecular Formula | C17H13N3O5S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl 1H-indazole-3-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2S1(=O)=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C17H13N3O5S/c21-16-12-6-2-4-8-14(12)26(23,24)20(16)9-10-25-17(22)15-11-5-1-3-7-13(11)18-19-15/h1-8H,9-10H2,(H,18,19) |
| InChIKey | ITWHRZMADBQNMD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |