C23H32O3 — CID 159232362
(2-tert-butyl-4-methoxyphenyl) 2-(1-adamantyl)acetate (PubChem CID 159232362) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (2-tert-butyl-4-methoxyphenyl) 2-(1-adamantyl)acetate.
| Compound Name | (2-tert-butyl-4-methoxyphenyl) 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 159232362 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (2-tert-butyl-4-methoxyphenyl) 2-(1-adamantyl)acetate |
| SMILES | COc1ccc(OC(=O)CC23CC4CC(CC(C4)C2)C3)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H32O3/c1-22(2,3)19-10-18(25-4)5-6-20(19)26-21(24)14-23-11-15-7-16(12-23)9-17(8-15)13-23/h5-6,10,15-17H,7-9,11-14H2,1-4H3 |
| InChIKey | KTBJHOBXHAFOAD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|