C20H26O3S — CID 8513275
2-(1-adamantylsulfanyl)-1-(2,4-dimethoxyphenyl)ethanone (PubChem CID 8513275) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-(1-adamantylsulfanyl)-1-(2,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-(1-adamantylsulfanyl)-1-(2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 8513275 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-(1-adamantylsulfanyl)-1-(2,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CSC23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C20H26O3S/c1-22-16-3-4-17(19(8-16)23-2)18(21)12-24-20-9-13-5-14(10-20)7-15(6-13)11-20/h3-4,8,13-15H,5-7,9-12H2,1-2H3 |
| InChIKey | OPXGJMKEBUBDIR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |