C23H31N3O4 — CID 171979000
N-[(E)-[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide (PubChem CID 171979000) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[(E)-[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 171979000 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[(E)-[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C(\C)CC(=O)NC23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C23H31N3O4/c1-14(25-26-22(28)19-5-4-18(29-2)10-20(19)30-3)6-21(27)24-23-11-15-7-16(12-23)9-17(8-15)13-23/h4-5,10,15-17H,6-9,11-13H2,1-3H3,(H,24,27)(H,26,28)/b25-14+ |
| InChIKey | CVPPTXRDEHLWSF-AFUMVMLFSA-N |
| XLogP | 3.28 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|